C9H6Cl2FN3 — CID 107581374
N-(3,5-dichloro-4-fluorophenyl)-1H-imidazol-2-amine (PubChem CID 107581374) has the molecular formula C9H6Cl2FN3 and a molecular weight of 246.07 g/mol. Its IUPAC name is N-(3,5-dichloro-4-fluorophenyl)-1H-imidazol-2-amine.
| Compound Name | N-(3,5-dichloro-4-fluorophenyl)-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 107581374 |
| Molecular Formula | C9H6Cl2FN3 |
| Molecular Weight | 246.07 g/mol |
| Exact Mass | 244.99 |
| IUPAC Name | N-(3,5-dichloro-4-fluorophenyl)-1H-imidazol-2-amine |
| SMILES | Fc1c(Cl)cc(Nc2ncc[nH]2)cc1Cl |
| InChI | InChI=1S/C9H6Cl2FN3/c10-6-3-5(4-7(11)8(6)12)15-9-13-1-2-14-9/h1-4H,(H2,13,14,15) |
| InChIKey | SDLDDBZTBYWNEO-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.07 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|