About 5-chloro-4-N-(3,5-dichloro-4-fluorophenyl)pyrimidine-4,6-diamine
5-chloro-4-N-(3,5-dichloro-4-fluorophenyl)pyrimidine-4,6-diamine (PubChem CID 114049905) has the molecular formula C10H6Cl3FN4
and a molecular weight of 307.54 g/mol. Its IUPAC name is 5-chloro-4-N-(3,5-dichloro-4-fluorophenyl)pyrimidine-4,6-diamine.
Molecular Properties
| Compound Name | 5-chloro-4-N-(3,5-dichloro-4-fluorophenyl)pyrimidine-4,6-diamine |
| PubChem CID | 114049905 |
| Molecular Formula | C10H6Cl3FN4 |
| Molecular Weight | 307.54 g/mol |
| Exact Mass | 305.96 |
| IUPAC Name | 5-chloro-4-N-(3,5-dichloro-4-fluorophenyl)pyrimidine-4,6-diamine |
| SMILES | Nc1ncnc(Nc2cc(Cl)c(F)c(Cl)c2)c1Cl |
| InChI | InChI=1S/C10H6Cl3FN4/c11-5-1-4(2-6(12)8(5)14)18-10-7(13)9(15)16-3-17-10/h1-3H,(H3,15,16,17,18) |
| InChIKey | ZBUMUQLOUFYMBZ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.54 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-4-N-(3,5-dichloro-4-fluorophenyl)pyrimidine-4,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-4-N-(3,5-dichloro-4-fluorophenyl)pyrimidine-4,6-diamine?
The IUPAC name of 5-chloro-4-N-(3,5-dichloro-4-fluorophenyl)pyrimidine-4,6-diamine (CID 114049905) is 5-chloro-4-N-(3,5-dichloro-4-fluorophenyl)pyrimidine-4,6-diamine.
What is the SMILES notation for 5-chloro-4-N-(3,5-dichloro-4-fluorophenyl)pyrimidine-4,6-diamine?
The canonical SMILES for 5-chloro-4-N-(3,5-dichloro-4-fluorophenyl)pyrimidine-4,6-diamine is Nc1ncnc(Nc2cc(Cl)c(F)c(Cl)c2)c1Cl.
What is the InChIKey of 5-chloro-4-N-(3,5-dichloro-4-fluorophenyl)pyrimidine-4,6-diamine?
The InChIKey is ZBUMUQLOUFYMBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6Cl3FN4/c11-5-1-4(2-6(12)8(5)14)18-10-7(13)9(15)16-3-17-10/h1-3H,(H3,15,16,17,18).
What are the key properties of 5-chloro-4-N-(3,5-dichloro-4-fluorophenyl)pyrimidine-4,6-diamine?
5-chloro-4-N-(3,5-dichloro-4-fluorophenyl)pyrimidine-4,6-diamine has a molecular weight of 307.54 g/mol, XLogP of 3.90, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-4-N-(3,5-dichloro-4-fluorophenyl)pyrimidine-4,6-diamine is sourced from PubChem (CID 114049905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).