C13H11Cl2FN2 — CID 107571479
3-N-(3,5-dichloro-4-fluorophenyl)-4-methylbenzene-1,3-diamine (PubChem CID 107571479) has the molecular formula C13H11Cl2FN2 and a molecular weight of 285.15 g/mol. Its IUPAC name is 3-N-(3,5-dichloro-4-fluorophenyl)-4-methylbenzene-1,3-diamine.
| Compound Name | 3-N-(3,5-dichloro-4-fluorophenyl)-4-methylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 107571479 |
| Molecular Formula | C13H11Cl2FN2 |
| Molecular Weight | 285.15 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | 3-N-(3,5-dichloro-4-fluorophenyl)-4-methylbenzene-1,3-diamine |
| SMILES | Cc1ccc(N)cc1Nc1cc(Cl)c(F)c(Cl)c1 |
| InChI | InChI=1S/C13H11Cl2FN2/c1-7-2-3-8(17)4-12(7)18-9-5-10(14)13(16)11(15)6-9/h2-6,18H,17H2,1H3 |
| InChIKey | IVYZPBDYJSRRNP-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.15 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|