C9H15N3 — CID 106581421
N-methyl-1-(3-methylcyclobutyl)imidazol-2-amine (PubChem CID 106581421) has the molecular formula C9H15N3 and a molecular weight of 165.24 g/mol. Its IUPAC name is N-methyl-1-(3-methylcyclobutyl)imidazol-2-amine.
| Compound Name | N-methyl-1-(3-methylcyclobutyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106581421 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | N-methyl-1-(3-methylcyclobutyl)imidazol-2-amine |
| SMILES | CNc1nccn1C1CC(C)C1 |
| InChI | InChI=1S/C9H15N3/c1-7-5-8(6-7)12-4-3-11-9(12)10-2/h3-4,7-8H,5-6H2,1-2H3,(H,10,11) |
| InChIKey | SJFGTWWOOSYGPT-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |