C14H23N5 — CID 106582984
N-butyl-4-methyl-1-[2-(2-methylpyrazol-3-yl)ethyl]imidazol-2-amine (PubChem CID 106582984) has the molecular formula C14H23N5 and a molecular weight of 261.37 g/mol. Its IUPAC name is N-butyl-4-methyl-1-[2-(2-methylpyrazol-3-yl)ethyl]imidazol-2-amine.
| Compound Name | N-butyl-4-methyl-1-[2-(2-methylpyrazol-3-yl)ethyl]imidazol-2-amine |
|---|---|
| PubChem CID | 106582984 |
| Molecular Formula | C14H23N5 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.20 |
| IUPAC Name | N-butyl-4-methyl-1-[2-(2-methylpyrazol-3-yl)ethyl]imidazol-2-amine |
| SMILES | CCCCNc1nc(C)cn1CCc1ccnn1C |
| InChI | InChI=1S/C14H23N5/c1-4-5-8-15-14-17-12(2)11-19(14)10-7-13-6-9-16-18(13)3/h6,9,11H,4-5,7-8,10H2,1-3H3,(H,15,17) |
| InChIKey | MBDOHBZSYNSLJP-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|