C10H17N3OS — CID 106583170
N-(2-methoxyethyl)-1-(thiolan-3-yl)imidazol-2-amine (PubChem CID 106583170) has the molecular formula C10H17N3OS and a molecular weight of 227.33 g/mol. Its IUPAC name is N-(2-methoxyethyl)-1-(thiolan-3-yl)imidazol-2-amine.
| Compound Name | N-(2-methoxyethyl)-1-(thiolan-3-yl)imidazol-2-amine |
|---|---|
| PubChem CID | 106583170 |
| Molecular Formula | C10H17N3OS |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | N-(2-methoxyethyl)-1-(thiolan-3-yl)imidazol-2-amine |
| SMILES | COCCNc1nccn1C1CCSC1 |
| InChI | InChI=1S/C10H17N3OS/c1-14-6-4-12-10-11-3-5-13(10)9-2-7-15-8-9/h3,5,9H,2,4,6-8H2,1H3,(H,11,12) |
| InChIKey | RLKWETCHFANBSB-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|