C15H13BrO4S — CID 106585002
3-(4-bromophenyl)sulfonyl-3,4-dihydro-2H-chromen-4-ol (PubChem CID 106585002) has the molecular formula C15H13BrO4S and a molecular weight of 369.24 g/mol. Its IUPAC name is 3-(4-bromophenyl)sulfonyl-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | 3-(4-bromophenyl)sulfonyl-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 106585002 |
| Molecular Formula | C15H13BrO4S |
| Molecular Weight | 369.24 g/mol |
| Exact Mass | 367.97 |
| IUPAC Name | 3-(4-bromophenyl)sulfonyl-3,4-dihydro-2H-chromen-4-ol |
| SMILES | O=S(=O)(c1ccc(Br)cc1)C1COc2ccccc2C1O |
| InChI | InChI=1S/C15H13BrO4S/c16-10-5-7-11(8-6-10)21(18,19)14-9-20-13-4-2-1-3-12(13)15(14)17/h1-8,14-15,17H,9H2 |
| InChIKey | UPVZKRTZCNTSTD-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.24 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |