C14H19F3O3S — CID 106585342
3-[3-(trifluoromethyl)phenyl]sulfonylheptan-4-ol (PubChem CID 106585342) has the molecular formula C14H19F3O3S and a molecular weight of 324.36 g/mol. Its IUPAC name is 3-[3-(trifluoromethyl)phenyl]sulfonylheptan-4-ol.
| Compound Name | 3-[3-(trifluoromethyl)phenyl]sulfonylheptan-4-ol |
|---|---|
| PubChem CID | 106585342 |
| Molecular Formula | C14H19F3O3S |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 3-[3-(trifluoromethyl)phenyl]sulfonylheptan-4-ol |
| SMILES | CCCC(O)C(CC)S(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H19F3O3S/c1-3-6-12(18)13(4-2)21(19,20)11-8-5-7-10(9-11)14(15,16)17/h5,7-9,12-13,18H,3-4,6H2,1-2H3 |
| InChIKey | QTEVFBGBVNFWOY-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |