C15H24O3S — CID 106585369
2-(4-tert-butylphenyl)sulfonylpentan-3-ol (PubChem CID 106585369) has the molecular formula C15H24O3S and a molecular weight of 284.42 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)sulfonylpentan-3-ol.
| Compound Name | 2-(4-tert-butylphenyl)sulfonylpentan-3-ol |
|---|---|
| PubChem CID | 106585369 |
| Molecular Formula | C15H24O3S |
| Molecular Weight | 284.42 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 2-(4-tert-butylphenyl)sulfonylpentan-3-ol |
| SMILES | CCC(O)C(C)S(=O)(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C15H24O3S/c1-6-14(16)11(2)19(17,18)13-9-7-12(8-10-13)15(3,4)5/h7-11,14,16H,6H2,1-5H3 |
| InChIKey | FXDJAQIDWZDZBW-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.42 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |