C15H32OSi — CID 10658771
tert-butyl-(2-tert-butylpent-4-enoxy)-dimethylsilane (PubChem CID 10658771) has the molecular formula C15H32OSi and a molecular weight of 256.51 g/mol. Its IUPAC name is tert-butyl-(2-tert-butylpent-4-enoxy)-dimethylsilane.
| Compound Name | tert-butyl-(2-tert-butylpent-4-enoxy)-dimethylsilane |
|---|---|
| PubChem CID | 10658771 |
| Molecular Formula | C15H32OSi |
| Molecular Weight | 256.51 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | tert-butyl-(2-tert-butylpent-4-enoxy)-dimethylsilane |
| SMILES | C=CCC(CO[Si](C)(C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C15H32OSi/c1-10-11-13(14(2,3)4)12-16-17(8,9)15(5,6)7/h10,13H,1,11-12H2,2-9H3 |
| InChIKey | OFPOMLKPAVGDJC-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.51 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|