C15H32O2Si — CID 139634859
[5,5-bis(methoxymethyl)-6-methylhept-2-enyl]-trimethylsilane (PubChem CID 139634859) has the molecular formula C15H32O2Si and a molecular weight of 272.50 g/mol. Its IUPAC name is [5,5-bis(methoxymethyl)-6-methylhept-2-enyl]-trimethylsilane.
| Compound Name | [5,5-bis(methoxymethyl)-6-methylhept-2-enyl]-trimethylsilane |
|---|---|
| PubChem CID | 139634859 |
| Molecular Formula | C15H32O2Si |
| Molecular Weight | 272.50 g/mol |
| Exact Mass | 272.22 |
| IUPAC Name | [5,5-bis(methoxymethyl)-6-methylhept-2-enyl]-trimethylsilane |
| SMILES | COCC(CC=CC[Si](C)(C)C)(COC)C(C)C |
| InChI | InChI=1S/C15H32O2Si/c1-14(2)15(12-16-3,13-17-4)10-8-9-11-18(5,6)7/h8-9,14H,10-13H2,1-7H3 |
| InChIKey | PNEKVEIBAXGUTK-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.50 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|