C27H60O2Si — CID 158118941
tert-butyl-methoxy-dimethylsilane;3-methoxy-2,2-dimethylpentane;(E)-7,8,8-trimethylnon-3-ene (PubChem CID 158118941) has the molecular formula C27H60O2Si and a molecular weight of 444.86 g/mol. Its IUPAC name is tert-butyl-methoxy-dimethylsilane;3-methoxy-2,2-dimethylpentane;(E)-7,8,8-trimethylnon-3-ene.
| Compound Name | tert-butyl-methoxy-dimethylsilane;3-methoxy-2,2-dimethylpentane;(E)-7,8,8-trimethylnon-3-ene |
|---|---|
| PubChem CID | 158118941 |
| Molecular Formula | C27H60O2Si |
| Molecular Weight | 444.86 g/mol |
| Exact Mass | 444.44 |
| IUPAC Name | tert-butyl-methoxy-dimethylsilane;3-methoxy-2,2-dimethylpentane;(E)-7,8,8-trimethylnon-3-ene |
| SMILES | CC/C=C/CCC(C)C(C)(C)C.CCC(OC)C(C)(C)C.CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H24.C8H18O.C7H18OSi/c1-6-7-8-9-10-11(2)12(3,4)5;1-6-7(9-5)8(2,3)4;1-7(2,3)9(5,6)8-4/h7-8,11H,6,9-10H2,1-5H3;7H,6H2,1-5H3;1-6H3/b8-7+;; |
| InChIKey | FRJDNIAFYFNKPS-MIIBGCIDSA-N |
| XLogP | 9.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.86 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|