C10H17N3O4S — CID 106594050
2-(aminomethyl)-N,N-bis(2-hydroxyethyl)pyridine-3-sulfonamide (PubChem CID 106594050) has the molecular formula C10H17N3O4S and a molecular weight of 275.33 g/mol. Its IUPAC name is 2-(aminomethyl)-N,N-bis(2-hydroxyethyl)pyridine-3-sulfonamide.
| Compound Name | 2-(aminomethyl)-N,N-bis(2-hydroxyethyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 106594050 |
| Molecular Formula | C10H17N3O4S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 2-(aminomethyl)-N,N-bis(2-hydroxyethyl)pyridine-3-sulfonamide |
| SMILES | NCc1ncccc1S(=O)(=O)N(CCO)CCO |
| InChI | InChI=1S/C10H17N3O4S/c11-8-9-10(2-1-3-12-9)18(16,17)13(4-6-14)5-7-15/h1-3,14-15H,4-8,11H2 |
| InChIKey | CRNDOBGNSMQALF-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 116.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |