C10H17N3O4S2 — CID 106594703
2-(aminomethyl)-N-methyl-N-(2-methylsulfonylethyl)pyridine-3-sulfonamide (PubChem CID 106594703) has the molecular formula C10H17N3O4S2 and a molecular weight of 307.40 g/mol. Its IUPAC name is 2-(aminomethyl)-N-methyl-N-(2-methylsulfonylethyl)pyridine-3-sulfonamide.
| Compound Name | 2-(aminomethyl)-N-methyl-N-(2-methylsulfonylethyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 106594703 |
| Molecular Formula | C10H17N3O4S2 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 2-(aminomethyl)-N-methyl-N-(2-methylsulfonylethyl)pyridine-3-sulfonamide |
| SMILES | CN(CCS(C)(=O)=O)S(=O)(=O)c1cccnc1CN |
| InChI | InChI=1S/C10H17N3O4S2/c1-13(6-7-18(2,14)15)19(16,17)10-4-3-5-12-9(10)8-11/h3-5H,6-8,11H2,1-2H3 |
| InChIKey | AAKGVQOBCHFORG-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 110.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |