C13H19N5O2S — CID 106594373
2-(aminomethyl)-N-[3-(5-methyl-1H-pyrazol-4-yl)propyl]pyridine-3-sulfonamide (PubChem CID 106594373) has the molecular formula C13H19N5O2S and a molecular weight of 309.40 g/mol. Its IUPAC name is 2-(aminomethyl)-N-[3-(5-methyl-1H-pyrazol-4-yl)propyl]pyridine-3-sulfonamide.
| Compound Name | 2-(aminomethyl)-N-[3-(5-methyl-1H-pyrazol-4-yl)propyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 106594373 |
| Molecular Formula | C13H19N5O2S |
| Molecular Weight | 309.40 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 2-(aminomethyl)-N-[3-(5-methyl-1H-pyrazol-4-yl)propyl]pyridine-3-sulfonamide |
| SMILES | Cc1[nH]ncc1CCCNS(=O)(=O)c1cccnc1CN |
| InChI | InChI=1S/C13H19N5O2S/c1-10-11(9-16-18-10)4-2-7-17-21(19,20)13-5-3-6-15-12(13)8-14/h3,5-6,9,17H,2,4,7-8,14H2,1H3,(H,16,18) |
| InChIKey | VROCVSXPAUZHLS-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.40 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|