C10H10ClN5O2 — CID 106597229
2-chloro-N'-hydroxy-6-[(1-methyl-1,2,4-triazol-3-yl)oxy]benzenecarboximidamide (PubChem CID 106597229) has the molecular formula C10H10ClN5O2 and a molecular weight of 267.68 g/mol. Its IUPAC name is 2-chloro-N'-hydroxy-6-[(1-methyl-1,2,4-triazol-3-yl)oxy]benzenecarboximidamide.
| Compound Name | 2-chloro-N'-hydroxy-6-[(1-methyl-1,2,4-triazol-3-yl)oxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 106597229 |
| Molecular Formula | C10H10ClN5O2 |
| Molecular Weight | 267.68 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | 2-chloro-N'-hydroxy-6-[(1-methyl-1,2,4-triazol-3-yl)oxy]benzenecarboximidamide |
| SMILES | Cn1cnc(Oc2cccc(Cl)c2/C(N)=N/O)n1 |
| InChI | InChI=1S/C10H10ClN5O2/c1-16-5-13-10(14-16)18-7-4-2-3-6(11)8(7)9(12)15-17/h2-5,17H,1H3,(H2,12,15) |
| InChIKey | AYUNWHVXNHVVBG-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 98.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.68 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|