C6H5BrCl2N2O — CID 10659749
2-(2-bromoethyl)-4,5-dichloropyridazin-3-one (PubChem CID 10659749) has the molecular formula C6H5BrCl2N2O and a molecular weight of 271.93 g/mol. Its IUPAC name is 2-(2-bromoethyl)-4,5-dichloropyridazin-3-one.
| Compound Name | 2-(2-bromoethyl)-4,5-dichloropyridazin-3-one |
|---|---|
| PubChem CID | 10659749 |
| Molecular Formula | C6H5BrCl2N2O |
| Molecular Weight | 271.93 g/mol |
| Exact Mass | 269.90 |
| IUPAC Name | 2-(2-bromoethyl)-4,5-dichloropyridazin-3-one |
| SMILES | O=c1c(Cl)c(Cl)cnn1CCBr |
| InChI | InChI=1S/C6H5BrCl2N2O/c7-1-2-11-6(12)5(9)4(8)3-10-11/h3H,1-2H2 |
| InChIKey | RMABZLBXMBMLAV-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.93 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|