About 2-(2-bromoethyl)-4,5-dichloropyridazin-3-one
2-(2-bromoethyl)-4,5-dichloropyridazin-3-one (PubChem CID 10659749) has the molecular formula C6H5BrCl2N2O
and a molecular weight of 271.93 g/mol. Its IUPAC name is 2-(2-bromoethyl)-4,5-dichloropyridazin-3-one.
Molecular Properties
| Compound Name | 2-(2-bromoethyl)-4,5-dichloropyridazin-3-one |
| PubChem CID | 10659749 |
| Molecular Formula | C6H5BrCl2N2O |
| Molecular Weight | 271.93 g/mol |
| Exact Mass | 269.90 |
| IUPAC Name | 2-(2-bromoethyl)-4,5-dichloropyridazin-3-one |
| SMILES | O=c1c(Cl)c(Cl)cnn1CCBr |
| InChI | InChI=1S/C6H5BrCl2N2O/c7-1-2-11-6(12)5(9)4(8)3-10-11/h3H,1-2H2 |
| InChIKey | RMABZLBXMBMLAV-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.93 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-bromoethyl)-4,5-dichloropyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-bromoethyl)-4,5-dichloropyridazin-3-one?
The IUPAC name of 2-(2-bromoethyl)-4,5-dichloropyridazin-3-one (CID 10659749) is 2-(2-bromoethyl)-4,5-dichloropyridazin-3-one.
What is the SMILES notation for 2-(2-bromoethyl)-4,5-dichloropyridazin-3-one?
The canonical SMILES for 2-(2-bromoethyl)-4,5-dichloropyridazin-3-one is O=c1c(Cl)c(Cl)cnn1CCBr.
What is the InChIKey of 2-(2-bromoethyl)-4,5-dichloropyridazin-3-one?
The InChIKey is RMABZLBXMBMLAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5BrCl2N2O/c7-1-2-11-6(12)5(9)4(8)3-10-11/h3H,1-2H2.
What are the key properties of 2-(2-bromoethyl)-4,5-dichloropyridazin-3-one?
2-(2-bromoethyl)-4,5-dichloropyridazin-3-one has a molecular weight of 271.93 g/mol, XLogP of 1.95, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-bromoethyl)-4,5-dichloropyridazin-3-one is sourced from PubChem (CID 10659749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).