C6H4Cl2F2N2O — CID 115616647
4,5-dichloro-2-(2,2-difluoroethyl)pyridazin-3-one (PubChem CID 115616647) has the molecular formula C6H4Cl2F2N2O and a molecular weight of 229.01 g/mol. Its IUPAC name is 4,5-dichloro-2-(2,2-difluoroethyl)pyridazin-3-one.
| Compound Name | 4,5-dichloro-2-(2,2-difluoroethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 115616647 |
| Molecular Formula | C6H4Cl2F2N2O |
| Molecular Weight | 229.01 g/mol |
| Exact Mass | 227.97 |
| IUPAC Name | 4,5-dichloro-2-(2,2-difluoroethyl)pyridazin-3-one |
| SMILES | O=c1c(Cl)c(Cl)cnn1CC(F)F |
| InChI | InChI=1S/C6H4Cl2F2N2O/c7-3-1-11-12(2-4(9)10)6(13)5(3)8/h1,4H,2H2 |
| InChIKey | LOPPGBSPFFHZIB-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.01 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |