C11H15N3O2S3 — CID 106597890
3-(thian-4-ylsulfamoyl)pyridine-2-carbothioamide (PubChem CID 106597890) has the molecular formula C11H15N3O2S3 and a molecular weight of 317.46 g/mol. Its IUPAC name is 3-(thian-4-ylsulfamoyl)pyridine-2-carbothioamide.
| Compound Name | 3-(thian-4-ylsulfamoyl)pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 106597890 |
| Molecular Formula | C11H15N3O2S3 |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | 3-(thian-4-ylsulfamoyl)pyridine-2-carbothioamide |
| SMILES | NC(=S)c1ncccc1S(=O)(=O)NC1CCSCC1 |
| InChI | InChI=1S/C11H15N3O2S3/c12-11(17)10-9(2-1-5-13-10)19(15,16)14-8-3-6-18-7-4-8/h1-2,5,8,14H,3-4,6-7H2,(H2,12,17) |
| InChIKey | AYSIRJMELHWKPM-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|