About N-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-1-[4-(1H-imidazol-5-yl)piperidin-1-yl]methanimine
N-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-1-[4-(1H-imidazol-5-yl)piperidin-1-yl]methanimine (PubChem CID 10659804) has the molecular formula C16H24N4
and a molecular weight of 272.40 g/mol. Its IUPAC name is N-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-1-[4-(1H-imidazol-5-yl)piperidin-1-yl]methanimine.
Molecular Properties
| Compound Name | N-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-1-[4-(1H-imidazol-5-yl)piperidin-1-yl]methanimine |
| PubChem CID | 10659804 |
| Molecular Formula | C16H24N4 |
| Molecular Weight | 272.40 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | N-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-1-[4-(1H-imidazol-5-yl)piperidin-1-yl]methanimine |
| SMILES | C(=N/[C@@H]1C[C@H]2CC[C@@H]1C2)\N1CCC(c2cnc[nH]2)CC1 |
| InChI | InChI=1S/C16H24N4/c1-2-14-7-12(1)8-15(14)19-11-20-5-3-13(4-6-20)16-9-17-10-18-16/h9-15H,1-8H2,(H,17,18)/b19-11+/t12-,14+,15+/m0/s1 |
| InChIKey | BHUKHINLRWKLNN-HXGWQWMGSA-N |
| XLogP | 2.81 |
| TPSA | 44.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-1-[4-(1H-imidazol-5-yl)piperidin-1-yl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-1-[4-(1H-imidazol-5-yl)piperidin-1-yl]methanimine?
The IUPAC name of N-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-1-[4-(1H-imidazol-5-yl)piperidin-1-yl]methanimine (CID 10659804) is N-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-1-[4-(1H-imidazol-5-yl)piperidin-1-yl]methanimine.
What is the SMILES notation for N-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-1-[4-(1H-imidazol-5-yl)piperidin-1-yl]methanimine?
The canonical SMILES for N-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-1-[4-(1H-imidazol-5-yl)piperidin-1-yl]methanimine is C(=N/[C@@H]1C[C@H]2CC[C@@H]1C2)\N1CCC(c2cnc[nH]2)CC1.
What is the InChIKey of N-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-1-[4-(1H-imidazol-5-yl)piperidin-1-yl]methanimine?
The InChIKey is BHUKHINLRWKLNN-HXGWQWMGSA-N. The full InChI is InChI=1S/C16H24N4/c1-2-14-7-12(1)8-15(14)19-11-20-5-3-13(4-6-20)16-9-17-10-18-16/h9-15H,1-8H2,(H,17,18)/b19-11+/t12-,14+,15+/m0/s1.
What are the key properties of N-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-1-[4-(1H-imidazol-5-yl)piperidin-1-yl]methanimine?
N-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-1-[4-(1H-imidazol-5-yl)piperidin-1-yl]methanimine has a molecular weight of 272.40 g/mol, XLogP of 2.81, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-1-[4-(1H-imidazol-5-yl)piperidin-1-yl]methanimine is sourced from PubChem (CID 10659804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).