C16H24N4 — CID 10659804
N-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-1-[4-(1H-imidazol-5-yl)piperidin-1-yl]methanimine (PubChem CID 10659804) has the molecular formula C16H24N4 and a molecular weight of 272.40 g/mol. Its IUPAC name is N-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-1-[4-(1H-imidazol-5-yl)piperidin-1-yl]methanimine.
| Compound Name | N-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-1-[4-(1H-imidazol-5-yl)piperidin-1-yl]methanimine |
|---|---|
| PubChem CID | 10659804 |
| Molecular Formula | C16H24N4 |
| Molecular Weight | 272.40 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | N-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-1-[4-(1H-imidazol-5-yl)piperidin-1-yl]methanimine |
| SMILES | C(=N/[C@@H]1C[C@H]2CC[C@@H]1C2)\N1CCC(c2cnc[nH]2)CC1 |
| InChI | InChI=1S/C16H24N4/c1-2-14-7-12(1)8-15(14)19-11-20-5-3-13(4-6-20)16-9-17-10-18-16/h9-15H,1-8H2,(H,17,18)/b19-11+/t12-,14+,15+/m0/s1 |
| InChIKey | BHUKHINLRWKLNN-HXGWQWMGSA-N |
| XLogP | 2.81 |
| TPSA | 44.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|