C14H16N6O — CID 106598677
4-[(1-methyl-1,2,4-triazol-3-yl)oxy]-N-propylquinazolin-2-amine (PubChem CID 106598677) has the molecular formula C14H16N6O and a molecular weight of 284.32 g/mol. Its IUPAC name is 4-[(1-methyl-1,2,4-triazol-3-yl)oxy]-N-propylquinazolin-2-amine.
| Compound Name | 4-[(1-methyl-1,2,4-triazol-3-yl)oxy]-N-propylquinazolin-2-amine |
|---|---|
| PubChem CID | 106598677 |
| Molecular Formula | C14H16N6O |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 4-[(1-methyl-1,2,4-triazol-3-yl)oxy]-N-propylquinazolin-2-amine |
| SMILES | CCCNc1nc(Oc2ncn(C)n2)c2ccccc2n1 |
| InChI | InChI=1S/C14H16N6O/c1-3-8-15-13-17-11-7-5-4-6-10(11)12(18-13)21-14-16-9-20(2)19-14/h4-7,9H,3,8H2,1-2H3,(H,15,17,18) |
| InChIKey | NANRJDDICBFPMU-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |