C9H10F2N4O2S — CID 106598697
N-(3-amino-2,2-difluoropropyl)-2-cyanopyridine-3-sulfonamide (PubChem CID 106598697) has the molecular formula C9H10F2N4O2S and a molecular weight of 276.27 g/mol. Its IUPAC name is N-(3-amino-2,2-difluoropropyl)-2-cyanopyridine-3-sulfonamide.
| Compound Name | N-(3-amino-2,2-difluoropropyl)-2-cyanopyridine-3-sulfonamide |
|---|---|
| PubChem CID | 106598697 |
| Molecular Formula | C9H10F2N4O2S |
| Molecular Weight | 276.27 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | N-(3-amino-2,2-difluoropropyl)-2-cyanopyridine-3-sulfonamide |
| SMILES | N#Cc1ncccc1S(=O)(=O)NCC(F)(F)CN |
| InChI | InChI=1S/C9H10F2N4O2S/c10-9(11,5-13)6-15-18(16,17)8-2-1-3-14-7(8)4-12/h1-3,15H,5-6,13H2 |
| InChIKey | FZOUGOUYUSVVLY-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 108.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.27 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |