C12H9IN2O2S — CID 106600587
2-(2,3-dihydro-1,4-benzoxathiin-2-yl)-5-iodo-1H-pyrimidin-6-one (PubChem CID 106600587) has the molecular formula C12H9IN2O2S and a molecular weight of 372.19 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzoxathiin-2-yl)-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 2-(2,3-dihydro-1,4-benzoxathiin-2-yl)-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 106600587 |
| Molecular Formula | C12H9IN2O2S |
| Molecular Weight | 372.19 g/mol |
| Exact Mass | 371.94 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzoxathiin-2-yl)-5-iodo-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(C2CSc3ccccc3O2)ncc1I |
| InChI | InChI=1S/C12H9IN2O2S/c13-7-5-14-11(15-12(7)16)9-6-18-10-4-2-1-3-8(10)17-9/h1-5,9H,6H2,(H,14,15,16) |
| InChIKey | HIMMHEBYITZQJQ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.19 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|