C14H13BrN2OS — CID 114205575
5-(bromomethyl)-2-(2,3-dihydro-1,4-benzoxathiin-2-yl)-4-methylpyrimidine (PubChem CID 114205575) has the molecular formula C14H13BrN2OS and a molecular weight of 337.24 g/mol. Its IUPAC name is 5-(bromomethyl)-2-(2,3-dihydro-1,4-benzoxathiin-2-yl)-4-methylpyrimidine.
| Compound Name | 5-(bromomethyl)-2-(2,3-dihydro-1,4-benzoxathiin-2-yl)-4-methylpyrimidine |
|---|---|
| PubChem CID | 114205575 |
| Molecular Formula | C14H13BrN2OS |
| Molecular Weight | 337.24 g/mol |
| Exact Mass | 335.99 |
| IUPAC Name | 5-(bromomethyl)-2-(2,3-dihydro-1,4-benzoxathiin-2-yl)-4-methylpyrimidine |
| SMILES | Cc1nc(C2CSc3ccccc3O2)ncc1CBr |
| InChI | InChI=1S/C14H13BrN2OS/c1-9-10(6-15)7-16-14(17-9)12-8-19-13-5-3-2-4-11(13)18-12/h2-5,7,12H,6,8H2,1H3 |
| InChIKey | OTSPDNFLYTZEDX-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.24 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|