C11H18O4S2 — CID 10660257
(E)-1-[(1R,3R)-2-[(E,1R)-1-hydroxybut-2-enyl]-1,3-dioxo-1,3-dithiolan-2-yl]but-2-en-1-ol (PubChem CID 10660257) has the molecular formula C11H18O4S2 and a molecular weight of 278.40 g/mol. Its IUPAC name is (E)-1-[(1R,3R)-2-[(E,1R)-1-hydroxybut-2-enyl]-1,3-dioxo-1,3-dithiolan-2-yl]but-2-en-1-ol.
| Compound Name | (E)-1-[(1R,3R)-2-[(E,1R)-1-hydroxybut-2-enyl]-1,3-dioxo-1,3-dithiolan-2-yl]but-2-en-1-ol |
|---|---|
| PubChem CID | 10660257 |
| Molecular Formula | C11H18O4S2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | (E)-1-[(1R,3R)-2-[(E,1R)-1-hydroxybut-2-enyl]-1,3-dioxo-1,3-dithiolan-2-yl]but-2-en-1-ol |
| SMILES | C/C=C/C(O)C1([C@H](O)/C=C/C)[S@](=O)CC[S@]1=O |
| InChI | InChI=1S/C11H18O4S2/c1-3-5-9(12)11(10(13)6-4-2)16(14)7-8-17(11)15/h3-6,9-10,12-13H,7-8H2,1-2H3/b5-3+,6-4+/t9-,10?,16-,17-/m1/s1 |
| InChIKey | PMLYFRXPSABLNC-LXSZLIOTSA-N |
| XLogP | 0.07 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|