C7H12O3S2 — CID 54742871
(E,1S)-1-[(1R,3S)-1,3-dioxo-1,3-dithiolan-2-yl]but-2-en-1-ol (PubChem CID 54742871) has the molecular formula C7H12O3S2 and a molecular weight of 208.30 g/mol. Its IUPAC name is (E,1S)-1-[(1R,3S)-1,3-dioxo-1,3-dithiolan-2-yl]but-2-en-1-ol.
| Compound Name | (E,1S)-1-[(1R,3S)-1,3-dioxo-1,3-dithiolan-2-yl]but-2-en-1-ol |
|---|---|
| PubChem CID | 54742871 |
| Molecular Formula | C7H12O3S2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.02 |
| IUPAC Name | (E,1S)-1-[(1R,3S)-1,3-dioxo-1,3-dithiolan-2-yl]but-2-en-1-ol |
| SMILES | C/C=C/[C@H](O)C1[S@](=O)CC[S@]1=O |
| InChI | InChI=1S/C7H12O3S2/c1-2-3-6(8)7-11(9)4-5-12(7)10/h2-3,6-8H,4-5H2,1H3/b3-2+/t6-,11+,12+/m0/s1 |
| InChIKey | ZGWHAJRFKIYONT-GAYIJLDHSA-N |
| XLogP | -0.24 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|