C17H13FN2O — CID 10660382
4-(4-fluorophenyl)-N-methylquinoline-3-carboxamide (PubChem CID 10660382) has the molecular formula C17H13FN2O and a molecular weight of 280.30 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N-methylquinoline-3-carboxamide.
| Compound Name | 4-(4-fluorophenyl)-N-methylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 10660382 |
| Molecular Formula | C17H13FN2O |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 4-(4-fluorophenyl)-N-methylquinoline-3-carboxamide |
| SMILES | CNC(=O)c1cnc2ccccc2c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C17H13FN2O/c1-19-17(21)14-10-20-15-5-3-2-4-13(15)16(14)11-6-8-12(18)9-7-11/h2-10H,1H3,(H,19,21) |
| InChIKey | UQWNZTYGUVQLCX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |