C13H20BrN3O — CID 106606967
2-[(5-bromo-3-pyridinyl)methyl-(pyrrolidin-2-ylmethyl)amino]ethanol (PubChem CID 106606967) has the molecular formula C13H20BrN3O and a molecular weight of 314.23 g/mol. Its IUPAC name is 2-[(5-bromo-3-pyridinyl)methyl-(pyrrolidin-2-ylmethyl)amino]ethanol.
| Compound Name | 2-[(5-bromo-3-pyridinyl)methyl-(pyrrolidin-2-ylmethyl)amino]ethanol |
|---|---|
| PubChem CID | 106606967 |
| Molecular Formula | C13H20BrN3O |
| Molecular Weight | 314.23 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 2-[(5-bromo-3-pyridinyl)methyl-(pyrrolidin-2-ylmethyl)amino]ethanol |
| SMILES | OCCN(Cc1cncc(Br)c1)CC1CCCN1 |
| InChI | InChI=1S/C13H20BrN3O/c14-12-6-11(7-15-8-12)9-17(4-5-18)10-13-2-1-3-16-13/h6-8,13,16,18H,1-5,9-10H2 |
| InChIKey | AWGOHXOSOSNGIF-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.23 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |