C15H21F3N2O — CID 106606388
2-[pyrrolidin-2-ylmethyl-[[3-(trifluoromethyl)phenyl]methyl]amino]ethanol (PubChem CID 106606388) has the molecular formula C15H21F3N2O and a molecular weight of 302.34 g/mol. Its IUPAC name is 2-[pyrrolidin-2-ylmethyl-[[3-(trifluoromethyl)phenyl]methyl]amino]ethanol.
| Compound Name | 2-[pyrrolidin-2-ylmethyl-[[3-(trifluoromethyl)phenyl]methyl]amino]ethanol |
|---|---|
| PubChem CID | 106606388 |
| Molecular Formula | C15H21F3N2O |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 2-[pyrrolidin-2-ylmethyl-[[3-(trifluoromethyl)phenyl]methyl]amino]ethanol |
| SMILES | OCCN(Cc1cccc(C(F)(F)F)c1)CC1CCCN1 |
| InChI | InChI=1S/C15H21F3N2O/c16-15(17,18)13-4-1-3-12(9-13)10-20(7-8-21)11-14-5-2-6-19-14/h1,3-4,9,14,19,21H,2,5-8,10-11H2 |
| InChIKey | KKJIDJUBENMMFK-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |