C14H21ClN2O2 — CID 106607083
3-chloro-2-[[2-hydroxyethyl(pyrrolidin-2-ylmethyl)amino]methyl]phenol (PubChem CID 106607083) has the molecular formula C14H21ClN2O2 and a molecular weight of 284.79 g/mol. Its IUPAC name is 3-chloro-2-[[2-hydroxyethyl(pyrrolidin-2-ylmethyl)amino]methyl]phenol.
| Compound Name | 3-chloro-2-[[2-hydroxyethyl(pyrrolidin-2-ylmethyl)amino]methyl]phenol |
|---|---|
| PubChem CID | 106607083 |
| Molecular Formula | C14H21ClN2O2 |
| Molecular Weight | 284.79 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 3-chloro-2-[[2-hydroxyethyl(pyrrolidin-2-ylmethyl)amino]methyl]phenol |
| SMILES | OCCN(Cc1c(O)cccc1Cl)CC1CCCN1 |
| InChI | InChI=1S/C14H21ClN2O2/c15-13-4-1-5-14(19)12(13)10-17(7-8-18)9-11-3-2-6-16-11/h1,4-5,11,16,18-19H,2-3,6-10H2 |
| InChIKey | ZIHNQBNYSUJBMP-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.79 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|