C13H22N4O3S — CID 106608029
4-[ethyl(pyrrolidin-2-ylmethyl)sulfamoyl]-1-methylpyrrole-2-carboxamide (PubChem CID 106608029) has the molecular formula C13H22N4O3S and a molecular weight of 314.41 g/mol. Its IUPAC name is 4-[ethyl(pyrrolidin-2-ylmethyl)sulfamoyl]-1-methylpyrrole-2-carboxamide.
| Compound Name | 4-[ethyl(pyrrolidin-2-ylmethyl)sulfamoyl]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 106608029 |
| Molecular Formula | C13H22N4O3S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 4-[ethyl(pyrrolidin-2-ylmethyl)sulfamoyl]-1-methylpyrrole-2-carboxamide |
| SMILES | CCN(CC1CCCN1)S(=O)(=O)c1cc(C(N)=O)n(C)c1 |
| InChI | InChI=1S/C13H22N4O3S/c1-3-17(8-10-5-4-6-15-10)21(19,20)11-7-12(13(14)18)16(2)9-11/h7,9-10,15H,3-6,8H2,1-2H3,(H2,14,18) |
| InChIKey | VMFBSPGSPVLZOR-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 97.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |