C13H23ClN4O3S — CID 126766175
1-methyl-4-[propyl(pyrrolidin-3-yl)sulfamoyl]pyrrole-2-carboxamide;hydrochloride (PubChem CID 126766175) has the molecular formula C13H23ClN4O3S and a molecular weight of 350.87 g/mol. Its IUPAC name is 1-methyl-4-[propyl(pyrrolidin-3-yl)sulfamoyl]pyrrole-2-carboxamide;hydrochloride.
| Compound Name | 1-methyl-4-[propyl(pyrrolidin-3-yl)sulfamoyl]pyrrole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 126766175 |
| Molecular Formula | C13H23ClN4O3S |
| Molecular Weight | 350.87 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 1-methyl-4-[propyl(pyrrolidin-3-yl)sulfamoyl]pyrrole-2-carboxamide;hydrochloride |
| SMILES | CCCN(C1CCNC1)S(=O)(=O)c1cc(C(N)=O)n(C)c1.Cl |
| InChI | InChI=1S/C13H22N4O3S.ClH/c1-3-6-17(10-4-5-15-8-10)21(19,20)11-7-12(13(14)18)16(2)9-11;/h7,9-10,15H,3-6,8H2,1-2H3,(H2,14,18);1H |
| InChIKey | IYTPPDKHZOHSMH-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 97.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.87 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |