C16H21N3O4S — CID 119976743
2-methyl-1,3-dioxo-N-propyl-N-pyrrolidin-3-ylisoindole-5-sulfonamide (PubChem CID 119976743) has the molecular formula C16H21N3O4S and a molecular weight of 351.43 g/mol. Its IUPAC name is 2-methyl-1,3-dioxo-N-propyl-N-pyrrolidin-3-ylisoindole-5-sulfonamide.
| Compound Name | 2-methyl-1,3-dioxo-N-propyl-N-pyrrolidin-3-ylisoindole-5-sulfonamide |
|---|---|
| PubChem CID | 119976743 |
| Molecular Formula | C16H21N3O4S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 2-methyl-1,3-dioxo-N-propyl-N-pyrrolidin-3-ylisoindole-5-sulfonamide |
| SMILES | CCCN(C1CCNC1)S(=O)(=O)c1ccc2c(c1)C(=O)N(C)C2=O |
| InChI | InChI=1S/C16H21N3O4S/c1-3-8-19(11-6-7-17-10-11)24(22,23)12-4-5-13-14(9-12)16(21)18(2)15(13)20/h4-5,9,11,17H,3,6-8,10H2,1-2H3 |
| InChIKey | XRLMZVYWEQLVSR-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|