C15H23N3O4S — CID 119976329
2-methoxy-5-[propyl(pyrrolidin-3-yl)sulfamoyl]benzamide (PubChem CID 119976329) has the molecular formula C15H23N3O4S and a molecular weight of 341.43 g/mol. Its IUPAC name is 2-methoxy-5-[propyl(pyrrolidin-3-yl)sulfamoyl]benzamide.
| Compound Name | 2-methoxy-5-[propyl(pyrrolidin-3-yl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 119976329 |
| Molecular Formula | C15H23N3O4S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 2-methoxy-5-[propyl(pyrrolidin-3-yl)sulfamoyl]benzamide |
| SMILES | CCCN(C1CCNC1)S(=O)(=O)c1ccc(OC)c(C(N)=O)c1 |
| InChI | InChI=1S/C15H23N3O4S/c1-3-8-18(11-6-7-17-10-11)23(20,21)12-4-5-14(22-2)13(9-12)15(16)19/h4-5,9,11,17H,3,6-8,10H2,1-2H3,(H2,16,19) |
| InChIKey | SKQBSRTZNOJCNA-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |