C16H20N2O3 — CID 10661007
tert-butyl N-[(1S)-1-(4-phenyl-1,3-oxazol-5-yl)ethyl]carbamate (PubChem CID 10661007) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-(4-phenyl-1,3-oxazol-5-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-(4-phenyl-1,3-oxazol-5-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 10661007 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | tert-butyl N-[(1S)-1-(4-phenyl-1,3-oxazol-5-yl)ethyl]carbamate |
| SMILES | C[C@H](NC(=O)OC(C)(C)C)c1ocnc1-c1ccccc1 |
| InChI | InChI=1S/C16H20N2O3/c1-11(18-15(19)21-16(2,3)4)14-13(17-10-20-14)12-8-6-5-7-9-12/h5-11H,1-4H3,(H,18,19)/t11-/m0/s1 |
| InChIKey | QXSZGCYWELMWTA-NSHDSACASA-N |
| XLogP | 3.93 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |