C15H26N4O2 — CID 106611603
2-ethyl-N-(2-methoxyethyl)-5-methyl-N-(pyrrolidin-2-ylmethyl)pyrazole-3-carboxamide (PubChem CID 106611603) has the molecular formula C15H26N4O2 and a molecular weight of 294.40 g/mol. Its IUPAC name is 2-ethyl-N-(2-methoxyethyl)-5-methyl-N-(pyrrolidin-2-ylmethyl)pyrazole-3-carboxamide.
| Compound Name | 2-ethyl-N-(2-methoxyethyl)-5-methyl-N-(pyrrolidin-2-ylmethyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 106611603 |
| Molecular Formula | C15H26N4O2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 2-ethyl-N-(2-methoxyethyl)-5-methyl-N-(pyrrolidin-2-ylmethyl)pyrazole-3-carboxamide |
| SMILES | CCn1nc(C)cc1C(=O)N(CCOC)CC1CCCN1 |
| InChI | InChI=1S/C15H26N4O2/c1-4-19-14(10-12(2)17-19)15(20)18(8-9-21-3)11-13-6-5-7-16-13/h10,13,16H,4-9,11H2,1-3H3 |
| InChIKey | CZMQYZMWAXKFPT-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |