C17H23N3O — CID 106612332
N-butyl-4-cyano-N-(pyrrolidin-2-ylmethyl)benzamide (PubChem CID 106612332) has the molecular formula C17H23N3O and a molecular weight of 285.39 g/mol. Its IUPAC name is N-butyl-4-cyano-N-(pyrrolidin-2-ylmethyl)benzamide.
| Compound Name | N-butyl-4-cyano-N-(pyrrolidin-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 106612332 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | N-butyl-4-cyano-N-(pyrrolidin-2-ylmethyl)benzamide |
| SMILES | CCCCN(CC1CCCN1)C(=O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C17H23N3O/c1-2-3-11-20(13-16-5-4-10-19-16)17(21)15-8-6-14(12-18)7-9-15/h6-9,16,19H,2-5,10-11,13H2,1H3 |
| InChIKey | HMYVUWRXRLWAJM-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |