C13H18N4 — CID 106619350
6-[ethyl(pyrrolidin-2-ylmethyl)amino]pyridine-3-carbonitrile (PubChem CID 106619350) has the molecular formula C13H18N4 and a molecular weight of 230.31 g/mol. Its IUPAC name is 6-[ethyl(pyrrolidin-2-ylmethyl)amino]pyridine-3-carbonitrile.
| Compound Name | 6-[ethyl(pyrrolidin-2-ylmethyl)amino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 106619350 |
| Molecular Formula | C13H18N4 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 6-[ethyl(pyrrolidin-2-ylmethyl)amino]pyridine-3-carbonitrile |
| SMILES | CCN(CC1CCCN1)c1ccc(C#N)cn1 |
| InChI | InChI=1S/C13H18N4/c1-2-17(10-12-4-3-7-15-12)13-6-5-11(8-14)9-16-13/h5-6,9,12,15H,2-4,7,10H2,1H3 |
| InChIKey | DMLPAXIAFDXTHI-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 51.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |