C13H19N5O — CID 144983920
2-[ethyl-[[(2R)-pyrrolidin-2-yl]methyl]amino]-4-methoxypyrimidine-5-carbonitrile (PubChem CID 144983920) has the molecular formula C13H19N5O and a molecular weight of 261.33 g/mol. Its IUPAC name is 2-[ethyl-[[(2R)-pyrrolidin-2-yl]methyl]amino]-4-methoxypyrimidine-5-carbonitrile.
| Compound Name | 2-[ethyl-[[(2R)-pyrrolidin-2-yl]methyl]amino]-4-methoxypyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 144983920 |
| Molecular Formula | C13H19N5O |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | 2-[ethyl-[[(2R)-pyrrolidin-2-yl]methyl]amino]-4-methoxypyrimidine-5-carbonitrile |
| SMILES | CCN(C[C@H]1CCCN1)c1ncc(C#N)c(OC)n1 |
| InChI | InChI=1S/C13H19N5O/c1-3-18(9-11-5-4-6-15-11)13-16-8-10(7-14)12(17-13)19-2/h8,11,15H,3-6,9H2,1-2H3/t11-/m1/s1 |
| InChIKey | FUWSSRLAPNYJBD-LLVKDONJSA-N |
| XLogP | 0.94 |
| TPSA | 74.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |