C14H20F2N2O2S — CID 106619501
4-(difluoromethylsulfonyl)-N-ethyl-N-(pyrrolidin-2-ylmethyl)aniline (PubChem CID 106619501) has the molecular formula C14H20F2N2O2S and a molecular weight of 318.39 g/mol. Its IUPAC name is 4-(difluoromethylsulfonyl)-N-ethyl-N-(pyrrolidin-2-ylmethyl)aniline.
| Compound Name | 4-(difluoromethylsulfonyl)-N-ethyl-N-(pyrrolidin-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 106619501 |
| Molecular Formula | C14H20F2N2O2S |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 4-(difluoromethylsulfonyl)-N-ethyl-N-(pyrrolidin-2-ylmethyl)aniline |
| SMILES | CCN(CC1CCCN1)c1ccc(S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C14H20F2N2O2S/c1-2-18(10-11-4-3-9-17-11)12-5-7-13(8-6-12)21(19,20)14(15)16/h5-8,11,14,17H,2-4,9-10H2,1H3 |
| InChIKey | QTALXXOEBKVKOF-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |