C13H20FN3O3S — CID 106621377
3-fluoro-4-[2-hydroxyethyl(pyrrolidin-2-ylmethyl)amino]benzenesulfonamide (PubChem CID 106621377) has the molecular formula C13H20FN3O3S and a molecular weight of 317.39 g/mol. Its IUPAC name is 3-fluoro-4-[2-hydroxyethyl(pyrrolidin-2-ylmethyl)amino]benzenesulfonamide.
| Compound Name | 3-fluoro-4-[2-hydroxyethyl(pyrrolidin-2-ylmethyl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 106621377 |
| Molecular Formula | C13H20FN3O3S |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 3-fluoro-4-[2-hydroxyethyl(pyrrolidin-2-ylmethyl)amino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(N(CCO)CC2CCCN2)c(F)c1 |
| InChI | InChI=1S/C13H20FN3O3S/c14-12-8-11(21(15,19)20)3-4-13(12)17(6-7-18)9-10-2-1-5-16-10/h3-4,8,10,16,18H,1-2,5-7,9H2,(H2,15,19,20) |
| InChIKey | XPQGMTCEUKFYPM-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |