C13H20FN3O2S — CID 106642160
3-fluoro-4-[methyl(piperidin-2-ylmethyl)amino]benzenesulfonamide (PubChem CID 106642160) has the molecular formula C13H20FN3O2S and a molecular weight of 301.39 g/mol. Its IUPAC name is 3-fluoro-4-[methyl(piperidin-2-ylmethyl)amino]benzenesulfonamide.
| Compound Name | 3-fluoro-4-[methyl(piperidin-2-ylmethyl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 106642160 |
| Molecular Formula | C13H20FN3O2S |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 3-fluoro-4-[methyl(piperidin-2-ylmethyl)amino]benzenesulfonamide |
| SMILES | CN(CC1CCCCN1)c1ccc(S(N)(=O)=O)cc1F |
| InChI | InChI=1S/C13H20FN3O2S/c1-17(9-10-4-2-3-7-16-10)13-6-5-11(8-12(13)14)20(15,18)19/h5-6,8,10,16H,2-4,7,9H2,1H3,(H2,15,18,19) |
| InChIKey | AIDOWDARQLUJKZ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |