C12H19N5O2 — CID 106621384
6-[2-hydroxyethyl(pyrrolidin-2-ylmethyl)amino]pyridazine-3-carboxamide (PubChem CID 106621384) has the molecular formula C12H19N5O2 and a molecular weight of 265.32 g/mol. Its IUPAC name is 6-[2-hydroxyethyl(pyrrolidin-2-ylmethyl)amino]pyridazine-3-carboxamide.
| Compound Name | 6-[2-hydroxyethyl(pyrrolidin-2-ylmethyl)amino]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 106621384 |
| Molecular Formula | C12H19N5O2 |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 6-[2-hydroxyethyl(pyrrolidin-2-ylmethyl)amino]pyridazine-3-carboxamide |
| SMILES | NC(=O)c1ccc(N(CCO)CC2CCCN2)nn1 |
| InChI | InChI=1S/C12H19N5O2/c13-12(19)10-3-4-11(16-15-10)17(6-7-18)8-9-2-1-5-14-9/h3-4,9,14,18H,1-2,5-8H2,(H2,13,19) |
| InChIKey | RACXVNCLPJUEOP-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |