C15H24N4O — CID 106620244
6-[butyl(pyrrolidin-2-ylmethyl)amino]pyridine-3-carboxamide (PubChem CID 106620244) has the molecular formula C15H24N4O and a molecular weight of 276.38 g/mol. Its IUPAC name is 6-[butyl(pyrrolidin-2-ylmethyl)amino]pyridine-3-carboxamide.
| Compound Name | 6-[butyl(pyrrolidin-2-ylmethyl)amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 106620244 |
| Molecular Formula | C15H24N4O |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | 6-[butyl(pyrrolidin-2-ylmethyl)amino]pyridine-3-carboxamide |
| SMILES | CCCCN(CC1CCCN1)c1ccc(C(N)=O)cn1 |
| InChI | InChI=1S/C15H24N4O/c1-2-3-9-19(11-13-5-4-8-17-13)14-7-6-12(10-18-14)15(16)20/h6-7,10,13,17H,2-5,8-9,11H2,1H3,(H2,16,20) |
| InChIKey | BSMRODSXFPTEMO-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |