C14H20F2OSSi — CID 10662155
(2,2-difluoro-1-phenylsulfanylethenoxy)-triethylsilane (PubChem CID 10662155) has the molecular formula C14H20F2OSSi and a molecular weight of 302.46 g/mol. Its IUPAC name is (2,2-difluoro-1-phenylsulfanylethenoxy)-triethylsilane.
| Compound Name | (2,2-difluoro-1-phenylsulfanylethenoxy)-triethylsilane |
|---|---|
| PubChem CID | 10662155 |
| Molecular Formula | C14H20F2OSSi |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | (2,2-difluoro-1-phenylsulfanylethenoxy)-triethylsilane |
| SMILES | CC[Si](CC)(CC)OC(Sc1ccccc1)=C(F)F |
| InChI | InChI=1S/C14H20F2OSSi/c1-4-19(5-2,6-3)17-14(13(15)16)18-12-10-8-7-9-11-12/h7-11H,4-6H2,1-3H3 |
| InChIKey | CHORAYXIFDNEOL-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|