C12H18F2O2SSi — CID 16744214
[3-(benzenesulfonyl)-3,3-difluoropropyl]-trimethylsilane (PubChem CID 16744214) has the molecular formula C12H18F2O2SSi and a molecular weight of 292.42 g/mol. Its IUPAC name is [3-(benzenesulfonyl)-3,3-difluoropropyl]-trimethylsilane.
| Compound Name | [3-(benzenesulfonyl)-3,3-difluoropropyl]-trimethylsilane |
|---|---|
| PubChem CID | 16744214 |
| Molecular Formula | C12H18F2O2SSi |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | [3-(benzenesulfonyl)-3,3-difluoropropyl]-trimethylsilane |
| SMILES | C[Si](C)(C)CCC(F)(F)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H18F2O2SSi/c1-18(2,3)10-9-12(13,14)17(15,16)11-7-5-4-6-8-11/h4-8H,9-10H2,1-3H3 |
| InChIKey | LIROXEAOABHNGT-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|