C17H25BrN2 — CID 106624762
N-[(2-bromo-4-methylphenyl)methyl]-N-(piperidin-3-ylmethyl)cyclopropanamine (PubChem CID 106624762) has the molecular formula C17H25BrN2 and a molecular weight of 337.31 g/mol. Its IUPAC name is N-[(2-bromo-4-methylphenyl)methyl]-N-(piperidin-3-ylmethyl)cyclopropanamine.
| Compound Name | N-[(2-bromo-4-methylphenyl)methyl]-N-(piperidin-3-ylmethyl)cyclopropanamine |
|---|---|
| PubChem CID | 106624762 |
| Molecular Formula | C17H25BrN2 |
| Molecular Weight | 337.31 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | N-[(2-bromo-4-methylphenyl)methyl]-N-(piperidin-3-ylmethyl)cyclopropanamine |
| SMILES | Cc1ccc(CN(CC2CCCNC2)C2CC2)c(Br)c1 |
| InChI | InChI=1S/C17H25BrN2/c1-13-4-5-15(17(18)9-13)12-20(16-6-7-16)11-14-3-2-8-19-10-14/h4-5,9,14,16,19H,2-3,6-8,10-12H2,1H3 |
| InChIKey | PELDSZDTCNFDQA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.31 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |