C15H22ClN3 — CID 106640251
N-[(3-chloro-4-pyridinyl)methyl]-N-(piperidin-3-ylmethyl)cyclopropanamine (PubChem CID 106640251) has the molecular formula C15H22ClN3 and a molecular weight of 279.81 g/mol. Its IUPAC name is N-[(3-chloro-4-pyridinyl)methyl]-N-(piperidin-3-ylmethyl)cyclopropanamine.
| Compound Name | N-[(3-chloro-4-pyridinyl)methyl]-N-(piperidin-3-ylmethyl)cyclopropanamine |
|---|---|
| PubChem CID | 106640251 |
| Molecular Formula | C15H22ClN3 |
| Molecular Weight | 279.81 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | N-[(3-chloro-4-pyridinyl)methyl]-N-(piperidin-3-ylmethyl)cyclopropanamine |
| SMILES | Clc1cnccc1CN(CC1CCCNC1)C1CC1 |
| InChI | InChI=1S/C15H22ClN3/c16-15-9-18-7-5-13(15)11-19(14-3-4-14)10-12-2-1-6-17-8-12/h5,7,9,12,14,17H,1-4,6,8,10-11H2 |
| InChIKey | WHMMKJMEZNYVHD-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.81 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |