C16H24Cl2N2 — CID 119930119
N-[(4-chlorophenyl)methyl]-N-(piperidin-3-ylmethyl)cyclopropanamine;hydrochloride (PubChem CID 119930119) has the molecular formula C16H24Cl2N2 and a molecular weight of 315.29 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-N-(piperidin-3-ylmethyl)cyclopropanamine;hydrochloride.
| Compound Name | N-[(4-chlorophenyl)methyl]-N-(piperidin-3-ylmethyl)cyclopropanamine;hydrochloride |
|---|---|
| PubChem CID | 119930119 |
| Molecular Formula | C16H24Cl2N2 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-N-(piperidin-3-ylmethyl)cyclopropanamine;hydrochloride |
| SMILES | Cl.Clc1ccc(CN(CC2CCCNC2)C2CC2)cc1 |
| InChI | InChI=1S/C16H23ClN2.ClH/c17-15-5-3-13(4-6-15)11-19(16-7-8-16)12-14-2-1-9-18-10-14;/h3-6,14,16,18H,1-2,7-12H2;1H |
| InChIKey | KJWKVGWRKPOFLB-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |