C17H34N2O — CID 106625371
N-(piperidin-3-ylmethyl)-N,2-dipropyloxan-4-amine (PubChem CID 106625371) has the molecular formula C17H34N2O and a molecular weight of 282.47 g/mol. Its IUPAC name is N-(piperidin-3-ylmethyl)-N,2-dipropyloxan-4-amine.
| Compound Name | N-(piperidin-3-ylmethyl)-N,2-dipropyloxan-4-amine |
|---|---|
| PubChem CID | 106625371 |
| Molecular Formula | C17H34N2O |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.27 |
| IUPAC Name | N-(piperidin-3-ylmethyl)-N,2-dipropyloxan-4-amine |
| SMILES | CCCC1CC(N(CCC)CC2CCCNC2)CCO1 |
| InChI | InChI=1S/C17H34N2O/c1-3-6-17-12-16(8-11-20-17)19(10-4-2)14-15-7-5-9-18-13-15/h15-18H,3-14H2,1-2H3 |
| InChIKey | SGLLHEJMRAKWRY-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |